Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2,3-Diamino-5-bromopyridine, 97%
CAS: 38875-53-5 Molecular Formula: C5H7BrN3 Molecular Weight (g/mol): 189.04 MDL Number: MFCD00460094 InChI Key: YRGMYJUKFJPNPD-UHFFFAOYSA-O Synonym: 2,3-diamino-5-bromopyridine,5-bromo-2,3-diaminopyridine,5-bromo-2,3-pyridinediamine,2,3-pyridinediamine, 5-bromo,3-amino-5-bromopyridin-2-yl amine,abbypharma ap-17-5972,5-brompyridin-2,3-diamin,pubchem5383,acmc-1adjl,5-brompyridin-2,3-diamine PubChem CID: 691156 IUPAC Name: 5-bromopyridine-2,3-diamine SMILES: NC1=CC(Br)=C[NH+]=C1N
| PubChem CID | 691156 |
|---|---|
| CAS | 38875-53-5 |
| Molecular Weight (g/mol) | 189.04 |
| MDL Number | MFCD00460094 |
| SMILES | NC1=CC(Br)=C[NH+]=C1N |
| Synonym | 2,3-diamino-5-bromopyridine,5-bromo-2,3-diaminopyridine,5-bromo-2,3-pyridinediamine,2,3-pyridinediamine, 5-bromo,3-amino-5-bromopyridin-2-yl amine,abbypharma ap-17-5972,5-brompyridin-2,3-diamin,pubchem5383,acmc-1adjl,5-brompyridin-2,3-diamine |
| IUPAC Name | 5-bromopyridine-2,3-diamine |
| InChI Key | YRGMYJUKFJPNPD-UHFFFAOYSA-O |
| Molecular Formula | C5H7BrN3 |
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide methiodide, 98%
CAS: 22572-40-3 Molecular Formula: C9H20IN3 Molecular Weight (g/mol): 297.18 MDL Number: MFCD00011833 InChI Key: JHMDMCSGQQLHNA-UHFFFAOYSA-N Synonym: 3-ethylimino methylidene amino-n,n,n-trimethylpropan-1-aminium,1-3-trimethylaminio propyl-3-ethylcarbodiimide,3-ethyliminomethylideneamino propyl-trimethylazanium,1-3-dimethylaminopropyl-3-ethylcarbodiimide methiodide,1-3-dimethylaminopropyl-3-ethylcarbodiimide, polymer-bound,3-ethylimino methylidene amino propyl trimethylazanium,1-3-dimethylaminopropyl-3-ethylcarbodiimide, polymer-bound, 200-400 mesh, 2 % cross-linked with divinylbenzene PubChem CID: 122243 IUPAC Name: 3-(ethyliminomethylideneamino)propyl-trimethylazanium SMILES: CCN=C=NCCC[N+](C)(C)C
| PubChem CID | 122243 |
|---|---|
| CAS | 22572-40-3 |
| Molecular Weight (g/mol) | 297.18 |
| MDL Number | MFCD00011833 |
| SMILES | CCN=C=NCCC[N+](C)(C)C |
| Synonym | 3-ethylimino methylidene amino-n,n,n-trimethylpropan-1-aminium,1-3-trimethylaminio propyl-3-ethylcarbodiimide,3-ethyliminomethylideneamino propyl-trimethylazanium,1-3-dimethylaminopropyl-3-ethylcarbodiimide methiodide,1-3-dimethylaminopropyl-3-ethylcarbodiimide, polymer-bound,3-ethylimino methylidene amino propyl trimethylazanium,1-3-dimethylaminopropyl-3-ethylcarbodiimide, polymer-bound, 200-400 mesh, 2 % cross-linked with divinylbenzene |
| IUPAC Name | 3-(ethyliminomethylideneamino)propyl-trimethylazanium |
| InChI Key | JHMDMCSGQQLHNA-UHFFFAOYSA-N |
| Molecular Formula | C9H20IN3 |
2-Bromo-4,5-difluorobenzoic acid, 97%
CAS: 64695-84-7 Molecular Formula: C7H3BrF2O2 Molecular Weight (g/mol): 237 MDL Number: MFCD04973422 InChI Key: DGCBGBZYTNTZJH-UHFFFAOYSA-N Synonym: 2-bromo-4,5-difluorobenzoicacid,2-bromo-4,5-difluoro-benzoic acid,benzoic acid, 2-bromo-4,5-difluoro,pubchem4991,acmc-209nnq,ksc495k3l,benzoic acid,2-bromo-4,5-difluoro,2-bromo-4,5-difluorobenzoic acid,2-bromanyl-4,5-bis fluoranyl benzoic acid PubChem CID: 2782789 IUPAC Name: 2-bromo-4,5-difluorobenzoic acid SMILES: C1=C(C(=CC(=C1F)F)Br)C(=O)O
| PubChem CID | 2782789 |
|---|---|
| CAS | 64695-84-7 |
| Molecular Weight (g/mol) | 237 |
| MDL Number | MFCD04973422 |
| SMILES | C1=C(C(=CC(=C1F)F)Br)C(=O)O |
| Synonym | 2-bromo-4,5-difluorobenzoicacid,2-bromo-4,5-difluoro-benzoic acid,benzoic acid, 2-bromo-4,5-difluoro,pubchem4991,acmc-209nnq,ksc495k3l,benzoic acid,2-bromo-4,5-difluoro,2-bromo-4,5-difluorobenzoic acid,2-bromanyl-4,5-bis fluoranyl benzoic acid |
| IUPAC Name | 2-bromo-4,5-difluorobenzoic acid |
| InChI Key | DGCBGBZYTNTZJH-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrF2O2 |
mono-Methyl terephthalate, 97%
CAS: 1679-64-7 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002557 InChI Key: REIDAMBAPLIATC-UHFFFAOYSA-N Synonym: 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate PubChem CID: 15513 IUPAC Name: 4-methoxycarbonylbenzoic acid SMILES: COC(=O)C1=CC=C(C=C1)C(=O)O
| PubChem CID | 15513 |
|---|---|
| CAS | 1679-64-7 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00002557 |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)O |
| Synonym | 4-methoxycarbonyl benzoic acid,mono-methyl terephthalate,monomethyl terephthalate,methyl terephthalate,methyl hydrogen terephthalate,1,4-benzenedicarboxylic acid, monomethyl ester,terephthalic acid monomethyl ester,1,4-benzenedicarboxylic acid monomethyl ester,terephthalic acid, monomethyl ester,hydrogen methyl terephthalate |
| IUPAC Name | 4-methoxycarbonylbenzoic acid |
| InChI Key | REIDAMBAPLIATC-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
4-Pyrazolecarboxylic acid, 97%
CAS: 37718-11-9 Molecular Formula: C4H4N2O2 Molecular Weight (g/mol): 112.09 MDL Number: MFCD00011558 InChI Key: IMBBXSASDSZJSX-UHFFFAOYSA-N Synonym: 4-pyrazolecarboxylic acid,4-carboxypyrazole,pyrazole-4-carboxylic acid,unii-4xjz84gv8e,1h-pyrazole-4-carboxylicacid,4-carboxy-1h-pyrazole,4xjz84gv8e,pyrazole-4-carboxylic,pubchem13293,pubchem22749 PubChem CID: 3015937 IUPAC Name: 1H-pyrazole-4-carboxylic acid SMILES: C1=C(C=NN1)C(=O)O
| PubChem CID | 3015937 |
|---|---|
| CAS | 37718-11-9 |
| Molecular Weight (g/mol) | 112.09 |
| MDL Number | MFCD00011558 |
| SMILES | C1=C(C=NN1)C(=O)O |
| Synonym | 4-pyrazolecarboxylic acid,4-carboxypyrazole,pyrazole-4-carboxylic acid,unii-4xjz84gv8e,1h-pyrazole-4-carboxylicacid,4-carboxy-1h-pyrazole,4xjz84gv8e,pyrazole-4-carboxylic,pubchem13293,pubchem22749 |
| IUPAC Name | 1H-pyrazole-4-carboxylic acid |
| InChI Key | IMBBXSASDSZJSX-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2 |
(S)-2-(Trifluoromethyl)piperidine, 97%
CAS: 154727-51-2 Molecular Formula: C6H10F3N Molecular Weight (g/mol): 153.15 InChI Key: NAXDEFXCCITWEU-YFKPBYRVSA-N Synonym: s-2-trifluoromethyl piperidine,2s-2-trifluoromethyl piperidine,s-2-trifluoromethylpiperidine,2alpha-trifluoromethyl piperidine PubChem CID: 42580051 IUPAC Name: (2S)-2-(trifluoromethyl)piperidine SMILES: C1CCNC(C1)C(F)(F)F
| PubChem CID | 42580051 |
|---|---|
| CAS | 154727-51-2 |
| Molecular Weight (g/mol) | 153.15 |
| SMILES | C1CCNC(C1)C(F)(F)F |
| Synonym | s-2-trifluoromethyl piperidine,2s-2-trifluoromethyl piperidine,s-2-trifluoromethylpiperidine,2alpha-trifluoromethyl piperidine |
| IUPAC Name | (2S)-2-(trifluoromethyl)piperidine |
| InChI Key | NAXDEFXCCITWEU-YFKPBYRVSA-N |
| Molecular Formula | C6H10F3N |
Honeywell Chemicals N-Methylpyrrolidone, B&J Brand™, for HPLC, GC and spectrophotometry, >99.5%, Honeywell Burdick & Jackson
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.133 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N Synonym: 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl PubChem CID: 13387 ChEBI: CHEBI:7307 IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| PubChem CID | 13387 |
|---|---|
| CAS | 872-50-4 |
| Molecular Weight (g/mol) | 99.133 |
| ChEBI | CHEBI:7307 |
| SMILES | CN1CCCC1=O |
| Synonym | 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Thermo Scientific Chemicals Barium diphenylaminesulfonate, pure, indicator grade
CAS: 6211-24-1 Molecular Formula: C24H20BaN2O6S2 Molecular Weight (g/mol): 633.88 MDL Number: MFCD00007497 InChI Key: IVCNVXFNTKXMCA-UHFFFAOYSA-L Synonym: barium diphenylamine-4-sulfonate,barium diphenylaminesulfonate,benzenesulfonic acid, 4-phenylamino-, barium salt 2:1,barium bis 4-anilinobenzenesulphonate,barium diphenylamine sulfonate,n-phenylsufanilic acid barium,unii-ssj5f79159,diphenylamine-4-sulfonic acid barium salt,n-phenylsufanilic acid, barium salt,4-anilinobenzenesulfonate; barium 2+ PubChem CID: 80342 IUPAC Name: 4-anilinobenzenesulfonate;barium(2+) SMILES: [Ba++].[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1.[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 80342 |
|---|---|
| CAS | 6211-24-1 |
| Molecular Weight (g/mol) | 633.88 |
| MDL Number | MFCD00007497 |
| SMILES | [Ba++].[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1.[O-]S(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | barium diphenylamine-4-sulfonate,barium diphenylaminesulfonate,benzenesulfonic acid, 4-phenylamino-, barium salt 2:1,barium bis 4-anilinobenzenesulphonate,barium diphenylamine sulfonate,n-phenylsufanilic acid barium,unii-ssj5f79159,diphenylamine-4-sulfonic acid barium salt,n-phenylsufanilic acid, barium salt,4-anilinobenzenesulfonate; barium 2+ |
| IUPAC Name | 4-anilinobenzenesulfonate;barium(2+) |
| InChI Key | IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| Molecular Formula | C24H20BaN2O6S2 |
(Trimethylsilyl)methyllithium, 0.7M (10 wt%) solution in hexanes, AcroSeal™
CAS: 1822-00-0 | C4H11LiSi | 94.16 g/mol
| Boiling Point | 65.0°C to 70.0°C |
|---|---|
| Linear Formula | LiCH2Si(CH3)3 |
| Molecular Weight (g/mol) | 94.16 |
| Color | Brown-Yellow to Colorless |
| Physical Form | Solution |
| CAS Min % | 86.0 |
| Chemical Name or Material | (Trimethylsilyl)methyllithium |
| SMILES | [Li+].C[Si](C)(C)[CH2-] |
| InChI Key | KVWLUDFGXDFFON-UHFFFAOYSA-N |
| Density | 0.6500g/mL |
| PubChem CID | 3482579 |
| Name Note | 0.8M (12 wt%) solution in hexanes |
| Percent Purity | 7 to 14 wt% |
| CAS | 92112-69-1 |
| Health Hazard 3 | GHS P Statement Wear eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00010747 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause d |
| Flash Point | −40°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | trimethylsilyl methyllithium,trimethylsilyl methyl lithium,lich2sime3,pubchem18144,tms-ch2li,lithiomethyltrimethylsilane,acmc-1bvf0,trimethylsilylmethyl lithium |
| IUPAC Name | lithium;methanidyl(trimethyl)silane |
| Molecular Formula | C4H11LiSi |
| Formula Weight | 94.16 |
| Specific Gravity | 0.65 |
| CAS Max % | 93.0 |
5-Indolylboronic acid, 97%
CAS: 144104-59-6 Molecular Formula: C8H8BNO2 Molecular Weight (g/mol): 160.97 MDL Number: MFCD01319013 InChI Key: VHADYSUJZAPXOW-UHFFFAOYSA-N Synonym: 5-indolylboronic acid,indole-5-boronic acid,1h-indol-5-yl boronic acid,1h-indole-5-boronic acid,5-indolboronic acid,5-indolyl boronic acid,5-indole-boronic acid,1h-indol-5-ylboranediol,5-indole boric acid,5-indoleboronic acid PubChem CID: 2734361 IUPAC Name: 1H-indol-5-ylboronic acid SMILES: OB(O)C1=CC=C2NC=CC2=C1
| PubChem CID | 2734361 |
|---|---|
| CAS | 144104-59-6 |
| Molecular Weight (g/mol) | 160.97 |
| MDL Number | MFCD01319013 |
| SMILES | OB(O)C1=CC=C2NC=CC2=C1 |
| Synonym | 5-indolylboronic acid,indole-5-boronic acid,1h-indol-5-yl boronic acid,1h-indole-5-boronic acid,5-indolboronic acid,5-indolyl boronic acid,5-indole-boronic acid,1h-indol-5-ylboranediol,5-indole boric acid,5-indoleboronic acid |
| IUPAC Name | 1H-indol-5-ylboronic acid |
| InChI Key | VHADYSUJZAPXOW-UHFFFAOYSA-N |
| Molecular Formula | C8H8BNO2 |
3-(3,5-Dichlorophenoxy)benzaldehyde, 95%, Thermo Scientific™
CAS: 81028-92-4 Molecular Formula: C13H8Cl2O2 Molecular Weight (g/mol): 267.11 MDL Number: MFCD00003355 InChI Key: BISWHYILBVQCRA-UHFFFAOYSA-N Synonym: 3-3,5-dichlorophenoxy benzaldehyde,3-3,5-dichorophenoxy benzaldehyde,m-3,5-dichlorophenoxy benzaldehyde,3,5-dichloro-3'-formyldiphenyl ether,benzaldehyde,3-3,5-dichlorophenoxy,benzaldehyde, 3-3,5-dichlorophenoxy,pubchem16379,acmc-20anl8,timtec-bb sbb003061,3-3?5-dichlorophenoxy benzaldehyde PubChem CID: 688050 IUPAC Name: 3-(3,5-dichlorophenoxy)benzaldehyde SMILES: ClC1=CC(OC2=CC=CC(C=O)=C2)=CC(Cl)=C1
| PubChem CID | 688050 |
|---|---|
| CAS | 81028-92-4 |
| Molecular Weight (g/mol) | 267.11 |
| MDL Number | MFCD00003355 |
| SMILES | ClC1=CC(OC2=CC=CC(C=O)=C2)=CC(Cl)=C1 |
| Synonym | 3-3,5-dichlorophenoxy benzaldehyde,3-3,5-dichorophenoxy benzaldehyde,m-3,5-dichlorophenoxy benzaldehyde,3,5-dichloro-3'-formyldiphenyl ether,benzaldehyde,3-3,5-dichlorophenoxy,benzaldehyde, 3-3,5-dichlorophenoxy,pubchem16379,acmc-20anl8,timtec-bb sbb003061,3-3?5-dichlorophenoxy benzaldehyde |
| IUPAC Name | 3-(3,5-dichlorophenoxy)benzaldehyde |
| InChI Key | BISWHYILBVQCRA-UHFFFAOYSA-N |
| Molecular Formula | C13H8Cl2O2 |
1,3,2-Dioxathiolane 2,2-dioxide, 96%, Thermo Scientific Chemicals
CAS: 1072-53-3 Molecular Formula: C2H4O4S Molecular Weight (g/mol): 124.12 MDL Number: MFCD00221769 InChI Key: ZPFAVCIQZKRBGF-UHFFFAOYSA-N Synonym: ethylenesulfate,ethylene sulfate,ethylene glycol, cyclic sulfate,glycol sulfate,1,2-ethylene sulfate,1,3,2-dioxathiolane, 2,2-dioxide,sulfuric acid, cyclic ethylene ester,1,3,2-dioxathiolane-2,2-dioxide,1,3,2??-dioxathiolane-2,2-dione,ethosulfate PubChem CID: 14075 IUPAC Name: 1,3,2-dioxathiolane 2,2-dioxide SMILES: C1COS(=O)(=O)O1
| PubChem CID | 14075 |
|---|---|
| CAS | 1072-53-3 |
| Molecular Weight (g/mol) | 124.12 |
| MDL Number | MFCD00221769 |
| SMILES | C1COS(=O)(=O)O1 |
| Synonym | ethylenesulfate,ethylene sulfate,ethylene glycol, cyclic sulfate,glycol sulfate,1,2-ethylene sulfate,1,3,2-dioxathiolane, 2,2-dioxide,sulfuric acid, cyclic ethylene ester,1,3,2-dioxathiolane-2,2-dioxide,1,3,2??-dioxathiolane-2,2-dione,ethosulfate |
| IUPAC Name | 1,3,2-dioxathiolane 2,2-dioxide |
| InChI Key | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| Molecular Formula | C2H4O4S |
Deoxybenzoin, 97%
CAS: 451-40-1 Molecular Formula: C14H12O Molecular Weight (g/mol): 196.25 MDL Number: MFCD00003081 InChI Key: OTKCEEWUXHVZQI-UHFFFAOYSA-N Synonym: 2-phenylacetophenone,deoxybenzoin,benzyl phenyl ketone,ethanone, 1,2-diphenyl,desoxybenzoin,1,2-diphenylethan-1-one,phenyl benzyl ketone,benzoin, deoxy,acetophenone, 2-phenyl,deoxy benzoin PubChem CID: 9948 IUPAC Name: 1,2-diphenylethanone SMILES: O=C(CC1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9948 |
|---|---|
| CAS | 451-40-1 |
| Molecular Weight (g/mol) | 196.25 |
| MDL Number | MFCD00003081 |
| SMILES | O=C(CC1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-phenylacetophenone,deoxybenzoin,benzyl phenyl ketone,ethanone, 1,2-diphenyl,desoxybenzoin,1,2-diphenylethan-1-one,phenyl benzyl ketone,benzoin, deoxy,acetophenone, 2-phenyl,deoxy benzoin |
| IUPAC Name | 1,2-diphenylethanone |
| InChI Key | OTKCEEWUXHVZQI-UHFFFAOYSA-N |
| Molecular Formula | C14H12O |
Ethyl bromopyruvate, 80-85%
CAS: 70-23-5 Molecular Formula: C5H7BrO3 Molecular Weight (g/mol): 195.01 MDL Number: MFCD00000204 InChI Key: VICYTAYPKBLQFB-UHFFFAOYSA-N Synonym: ethyl bromopyruvate,ethyl 3-bromopyruvate,propanoic acid, 3-bromo-2-oxo-, ethyl ester,bromopyruvic acid ethyl ester,ethyl bromo pyruvate,ethyl 3-bromo-2-oxopropionate,pyruvic acid, bromo-, ethyl ester,.beta.-bromopyruvic acid ethyl ester,3-bromo-2-oxo-propionic acid ethyl ester,beta-bromopyruvic acid ethyl ester PubChem CID: 66144 IUPAC Name: ethyl 3-bromo-2-oxopropanoate SMILES: CCOC(=O)C(=O)CBr
| PubChem CID | 66144 |
|---|---|
| CAS | 70-23-5 |
| Molecular Weight (g/mol) | 195.01 |
| MDL Number | MFCD00000204 |
| SMILES | CCOC(=O)C(=O)CBr |
| Synonym | ethyl bromopyruvate,ethyl 3-bromopyruvate,propanoic acid, 3-bromo-2-oxo-, ethyl ester,bromopyruvic acid ethyl ester,ethyl bromo pyruvate,ethyl 3-bromo-2-oxopropionate,pyruvic acid, bromo-, ethyl ester,.beta.-bromopyruvic acid ethyl ester,3-bromo-2-oxo-propionic acid ethyl ester,beta-bromopyruvic acid ethyl ester |
| IUPAC Name | ethyl 3-bromo-2-oxopropanoate |
| InChI Key | VICYTAYPKBLQFB-UHFFFAOYSA-N |
| Molecular Formula | C5H7BrO3 |
Poly(acrylic acid), sec. stand., aver. MW 1,080,000, aver. MN 135,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |